CAS 1049740-52-4 is the registry number for (2S,4R)-4-(2,4-Dichlorobenzyl)pyrrolidine-2-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2S,4R)-4-[(2,4-dichlorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride (CAS 1049740-52-4) is a chemical compound with the molecular formula C12H14Cl3NO2 and a molecular weight of 310.6 g/mol. IUPAC name: (2S,4R)-4-[(2,4-dichlorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: DODAZHGHYBWICW-YERNIVPCSA-N.
| Molecular formula | C12H14Cl3NO2 |
|---|---|
| Molecular weight | 310.6 g/mol |
| IUPAC name | (2S,4R)-4-[(2,4-dichlorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | DODAZHGHYBWICW-YERNIVPCSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)CC2=C(C=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)