CAS 1423025-21-1 appears in our catalog under these names: 2-((Cyclopropylmethyl)amino)-2-(3,5-dichlorophenyl)acetic acid hydrochloride, 95%, 2-((Cyclopropylmethyl)amino)-2-(3,5-dichlorophenyl)acetic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(cyclopropylmethylamino)-2-(3,5-dichlorophenyl)acetic acid;hydrochloride (CAS 1423025-21-1) is a chemical compound with the molecular formula C12H14Cl3NO2 and a molecular weight of 310.6 g/mol. IUPAC name: 2-(cyclopropylmethylamino)-2-(3,5-dichlorophenyl)acetic acid;hydrochloride. InChIKey: GNUFBLQKHWYIAA-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl3NO2 |
|---|---|
| Molecular weight | 310.6 g/mol |
| IUPAC name | 2-(cyclopropylmethylamino)-2-(3,5-dichlorophenyl)acetic acid;hydrochloride |
| InChIKey | GNUFBLQKHWYIAA-UHFFFAOYSA-N |
| SMILES | C1CC1CNC(C2=CC(=CC(=C2)Cl)Cl)C(=O)O.Cl |
Computed by PubChem (NCBI)