CAS 1049751-82-7 appears in our catalog under these names: 2-Amino-n-(2,3-dimethylphenyl)acetamide hydrochloride, 95%, N~1~-(2,3-Dimethylphenyl)glycinamide hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g.
2-amino-N-(2,3-dimethylphenyl)acetamide;hydrochloride (CAS 1049751-82-7) is a chemical compound with the molecular formula C10H15ClN2O and a molecular weight of 214.69 g/mol. IUPAC name: 2-amino-N-(2,3-dimethylphenyl)acetamide;hydrochloride. InChIKey: SDFZRKYWIZZTPT-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O |
|---|---|
| Molecular weight | 214.69 g/mol |
| IUPAC name | 2-amino-N-(2,3-dimethylphenyl)acetamide;hydrochloride |
| InChIKey | SDFZRKYWIZZTPT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NC(=O)CN)C.Cl |
Computed by PubChem (NCBI)