Products 2103396-51-4
CAS 2103396-51-4 appears in our catalog under these names: 3-(Aminomethyl)-n,n-dimethylbenzamide hydrochloride, 95%, 3-(Aminomethyl)-N,N-dimethylbenzamide hydrochloride, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
3-(aminomethyl)-N,N-dimethylbenzamide;hydrochloride (CAS 2103396-51-4) is a chemical compound with the molecular formula C10H15ClN2O and a molecular weight of 214.69 g/mol. IUPAC name: 3-(aminomethyl)-N,N-dimethylbenzamide;hydrochloride. InChIKey: XYUMASYTGWJABX-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O |
|---|---|
| Molecular weight | 214.69 g/mol |
| IUPAC name | 3-(aminomethyl)-N,N-dimethylbenzamide;hydrochloride |
| InChIKey | XYUMASYTGWJABX-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=CC(=C1)CN.Cl |
Computed by PubChem (NCBI)