Products 664313-07-9
CAS 664313-07-9 appears in our catalog under these names: N-(2-Amino-4,6-dimethylphenyl)acetamide hydrochloride, 95%, N-(2-Amino-4,6-dimethylphenyl)acetamide 95%, N-(2-amino-4,6-dimethylphenyl)acetamide, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
N-(2-amino-4,6-dimethylphenyl)acetamide;hydrochloride (CAS 664313-07-9) is a chemical compound with the molecular formula C10H15ClN2O and a molecular weight of 214.69 g/mol. IUPAC name: N-(2-amino-4,6-dimethylphenyl)acetamide;hydrochloride. InChIKey: DRJPAIZTAYYJIO-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O |
|---|---|
| Molecular weight | 214.69 g/mol |
| IUPAC name | N-(2-amino-4,6-dimethylphenyl)acetamide;hydrochloride |
| InChIKey | DRJPAIZTAYYJIO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)N)NC(=O)C)C.Cl |
Computed by PubChem (NCBI)