CAS 1175036-51-7 appears in our catalog under these names: 1-(4-Hydroxyphenyl)piperazine hydrochloride, 95%, 4-(Piperazin-1-yl)phenol hydrochloride, 95%, 95%, 4-(Piperazin-1-yl)phenol hydrochloride, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
4-piperazin-1-ylphenol;hydrochloride (CAS 1175036-51-7) is a chemical compound with the molecular formula C10H15ClN2O and a molecular weight of 214.69 g/mol. IUPAC name: 4-piperazin-1-ylphenol;hydrochloride. InChIKey: HOQZYXZHPXPKCX-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O |
|---|---|
| Molecular weight | 214.69 g/mol |
| IUPAC name | 4-piperazin-1-ylphenol;hydrochloride |
| InChIKey | HOQZYXZHPXPKCX-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)O.Cl |
Computed by PubChem (NCBI)