CAS 1414960-53-4 appears in our catalog under these names: (R)-N-[4-(1-Amino-ethyl)-phenyl]-acetamide hydrochloride, 95%, (R)–N–(4–(1–Amino–ethyl)–phenyl)–acetamide hydrochloride, (R)-N-[4-(1-Amino-ethyl)-phenyl]-acetamide hydrochloride 97%, (R)-N-[4-(1-Amino-ethyl)-phenyl]-acetamide hydrochloride, 97%, 97%, (R)-N-[4-(1-Amino-ethyl)-phenyl]-acetamide hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
N-[4-[(1R)-1-aminoethyl]phenyl]acetamide;hydrochloride (CAS 1414960-53-4) is a chemical compound with the molecular formula C10H15ClN2O and a molecular weight of 214.69 g/mol. IUPAC name: N-[4-[(1R)-1-aminoethyl]phenyl]acetamide;hydrochloride. InChIKey: CJMAKPYPZQWWSK-OGFXRTJISA-N.
| Molecular formula | C10H15ClN2O |
|---|---|
| Molecular weight | 214.69 g/mol |
| IUPAC name | N-[4-[(1R)-1-aminoethyl]phenyl]acetamide;hydrochloride |
| InChIKey | CJMAKPYPZQWWSK-OGFXRTJISA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)NC(=O)C)N.Cl |
Computed by PubChem (NCBI)