Products 1049782-92-4
CAS 1049782-92-4 appears in our catalog under these names: Methyl 5-(aminomethyl)-2-methoxybenzoate hydrochloride, 95%, Methyl 5-(aminomethyl)-2-methoxybenzoate, HCl, 95%, methyl 5-(aminomethyl)-2-methoxybenzoate hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 50mg, 0,5g.
Methyl 5-(aminomethyl)-2-methoxybenzoate;hydrochloride (CAS 1049782-92-4) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl 5-(aminomethyl)-2-methoxybenzoate;hydrochloride. InChIKey: FWUSELINWADQCC-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl 5-(aminomethyl)-2-methoxybenzoate;hydrochloride |
| InChIKey | FWUSELINWADQCC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CN)C(=O)OC.Cl |
Computed by PubChem (NCBI)