CAS 1049784-98-6 appears in our catalog under these names: 5-Chloro-2-(4-chloro-2,6-dimethylphenoxy)aniline hydrochloride, 95%, 5-Chloro-2-(4-chloro-2,6-dimethylphenoxy)aniline hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
5-chloro-2-(4-chloro-2,6-dimethylphenoxy)aniline;hydrochloride (CAS 1049784-98-6) is a chemical compound with the molecular formula C14H14Cl3NO and a molecular weight of 318.6 g/mol. IUPAC name: 5-chloro-2-(4-chloro-2,6-dimethylphenoxy)aniline;hydrochloride. InChIKey: FPSBSVIZCVNKAN-UHFFFAOYSA-N.
| Molecular formula | C14H14Cl3NO |
|---|---|
| Molecular weight | 318.6 g/mol |
| IUPAC name | 5-chloro-2-(4-chloro-2,6-dimethylphenoxy)aniline;hydrochloride |
| InChIKey | FPSBSVIZCVNKAN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OC2=C(C=C(C=C2)Cl)N)C)Cl.Cl |
Computed by PubChem (NCBI)