Products 1221724-11-3
CAS 1221724-11-3 is the registry number for (4-(2,4-Dichlorophenoxy)-3-methylphenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[4-(2,4-dichlorophenoxy)-3-methylphenyl]methanamine;hydrochloride (CAS 1221724-11-3) is a chemical compound with the molecular formula C14H14Cl3NO and a molecular weight of 318.6 g/mol. IUPAC name: [4-(2,4-dichlorophenoxy)-3-methylphenyl]methanamine;hydrochloride. InChIKey: WDTRZPZOQHXRJK-UHFFFAOYSA-N.
| Molecular formula | C14H14Cl3NO |
|---|---|
| Molecular weight | 318.6 g/mol |
| IUPAC name | [4-(2,4-dichlorophenoxy)-3-methylphenyl]methanamine;hydrochloride |
| InChIKey | WDTRZPZOQHXRJK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)CN)OC2=C(C=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)