CAS 543730-63-8 is the registry number for Benzenemethanamine, 3,4-dichloro-n-(phenylmethoxy)-, hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(3,4-dichlorophenyl)-N-phenylmethoxymethanamine;hydrochloride (CAS 543730-63-8) is a chemical compound with the molecular formula C14H14Cl3NO and a molecular weight of 318.6 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-N-phenylmethoxymethanamine;hydrochloride. InChIKey: KYHNOAQNZCSZHP-UHFFFAOYSA-N.
| Molecular formula | C14H14Cl3NO |
|---|---|
| Molecular weight | 318.6 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-N-phenylmethoxymethanamine;hydrochloride |
| InChIKey | KYHNOAQNZCSZHP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CONCC2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)