CAS 1049791-66-3 appears in our catalog under these names: (4-(Benzyloxy)-3,5-dichlorophenyl)methanamine hydrochloride, 96%, 96%, 3.5-Dichloro-4-benzyloxybenzylamine hydrochloride, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 5mg, 10mg.
(3,5-dichloro-4-phenylmethoxyphenyl)methanamine;hydrochloride (CAS 1049791-66-3) is a chemical compound with the molecular formula C14H14Cl3NO and a molecular weight of 318.6 g/mol. IUPAC name: (3,5-dichloro-4-phenylmethoxyphenyl)methanamine;hydrochloride. InChIKey: KOHUFJWJXPTFMX-UHFFFAOYSA-N.
| Molecular formula | C14H14Cl3NO |
|---|---|
| Molecular weight | 318.6 g/mol |
| IUPAC name | (3,5-dichloro-4-phenylmethoxyphenyl)methanamine;hydrochloride |
| InChIKey | KOHUFJWJXPTFMX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2Cl)CN)Cl.Cl |
Computed by PubChem (NCBI)