CAS 1171507-41-7 is the registry number for 3,5-Dichloro-N-((2-methoxyphenyl)methyl)aniline hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 10g.
3,5-dichloro-N-[(2-methoxyphenyl)methyl]aniline;hydrochloride (CAS 1171507-41-7) is a chemical compound with the molecular formula C14H14Cl3NO and a molecular weight of 318.6 g/mol. IUPAC name: 3,5-dichloro-N-[(2-methoxyphenyl)methyl]aniline;hydrochloride. InChIKey: RTZCQYFPTVBRNU-UHFFFAOYSA-N.
| Molecular formula | C14H14Cl3NO |
|---|---|
| Molecular weight | 318.6 g/mol |
| IUPAC name | 3,5-dichloro-N-[(2-methoxyphenyl)methyl]aniline;hydrochloride |
| InChIKey | RTZCQYFPTVBRNU-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1CNC2=CC(=CC(=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)