Products 1049872-54-9
CAS 1049872-54-9 appears in our catalog under these names: 2-Chloro-N-(2-(4-chlorophenoxy)ethyl)-N-methylpropanamide, 95%, 2-Chloro-N-(2-(4-chlorophenoxy)ethyl)-N-methylpropanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-chloro-N-[2-(4-chlorophenoxy)ethyl]-N-methylpropanamide (CAS 1049872-54-9) is a chemical compound with the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. IUPAC name: 2-chloro-N-[2-(4-chlorophenoxy)ethyl]-N-methylpropanamide. InChIKey: RUAKVJUANQEEFS-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO2 |
|---|---|
| Molecular weight | 276.16 g/mol |
| IUPAC name | 2-chloro-N-[2-(4-chlorophenoxy)ethyl]-N-methylpropanamide |
| InChIKey | RUAKVJUANQEEFS-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N(C)CCOC1=CC=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)