Products 69195-96-6
CAS 69195-96-6 is the registry number for 1-Benzyl-5-nitro-1H-imidazole-4-carboxylic acid, 95+%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 10g.
1-benzyl-5-nitroimidazole-4-carboxylic acid (CAS 69195-96-6) is a chemical compound with the molecular formula C11H9N3O4 and a molecular weight of 247.21 g/mol. IUPAC name: 1-benzyl-5-nitroimidazole-4-carboxylic acid. InChIKey: AOEZXACMKKLMIY-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O4 |
|---|---|
| Molecular weight | 247.21 g/mol |
| IUPAC name | 1-benzyl-5-nitroimidazole-4-carboxylic acid |
| InChIKey | AOEZXACMKKLMIY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=NC(=C2[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)