CAS 1050591-26-8 appears in our catalog under these names: 4-([(2-Furylmethyl)amino]methyl)benzoic acid hydrochloride, 95%, 4-(((Furan-2-ylmethyl)amino)methyl)benzoic acid hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-[(furan-2-ylmethylamino)methyl]benzoic acid;hydrochloride (CAS 1050591-26-8) is a chemical compound with the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. IUPAC name: 4-[(furan-2-ylmethylamino)methyl]benzoic acid;hydrochloride. InChIKey: SYXGZGAYQYQRSU-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO3 |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | 4-[(furan-2-ylmethylamino)methyl]benzoic acid;hydrochloride |
| InChIKey | SYXGZGAYQYQRSU-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CNCC2=CC=C(C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)