Products 345367-42-2

CAS 345367-42-2 is the registry number for 1-(3-Chloro-4-methyl-phenyl)-5-oxo-pyrrolidine-3-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carboxylate (CAS 345367-42-2) is a chemical compound with the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. IUPAC name: methyl 1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carboxylate. InChIKey: OUWJLVKVTUYIJB-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14ClNO3
Molecular weight267.71 g/mol
IUPAC namemethyl 1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carboxylate
InChIKeyOUWJLVKVTUYIJB-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)N2CC(CC2=O)C(=O)OC)Cl

Computed by PubChem (NCBI)