Products 436093-15-1
CAS 436093-15-1 is the registry number for 1-(4-Chloro-benzoyl)-piperidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(4-chlorobenzoyl)piperidine-3-carboxylic acid (CAS 436093-15-1) is a chemical compound with the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. IUPAC name: 1-(4-chlorobenzoyl)piperidine-3-carboxylic acid. InChIKey: DGUQEGBVTIEEKQ-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO3 |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | 1-(4-chlorobenzoyl)piperidine-3-carboxylic acid |
| InChIKey | DGUQEGBVTIEEKQ-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)