Products 379724-54-6

CAS 379724-54-6 is the registry number for 1-(4-Chlorobenzoyl)-4-piperidinecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-(4-chlorobenzoyl)piperidine-4-carboxylic acid (CAS 379724-54-6) is a chemical compound with the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. IUPAC name: 1-(4-chlorobenzoyl)piperidine-4-carboxylic acid. InChIKey: FGLQAKJRFPNIJT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14ClNO3
Molecular weight267.71 g/mol
IUPAC name1-(4-chlorobenzoyl)piperidine-4-carboxylic acid
InChIKeyFGLQAKJRFPNIJT-UHFFFAOYSA-N
SMILESC1CN(CCC1C(=O)O)C(=O)C2=CC=C(C=C2)Cl

Computed by PubChem (NCBI)