CAS 907200-66-2 appears in our catalog under these names: 4-(Chloromethyl)-2-(3,4-dimethoxyphenyl)-5-methyloxazole, 95+%, 4-(Chloromethyl)-2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazole, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-(chloromethyl)-2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazole (CAS 907200-66-2) is a chemical compound with the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. IUPAC name: 4-(chloromethyl)-2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazole. InChIKey: CWEJNAPEPLYACX-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO3 |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazole |
| InChIKey | CWEJNAPEPLYACX-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC(=C(C=C2)OC)OC)CCl |
Computed by PubChem (NCBI)