CAS 1050910-24-1 is the registry number for 4-(3-(2-Methoxy-2-oxoethyl)-5-oxo-2,5-dihydro-1H-pyrazol-1-yl)benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-[5-(2-methoxy-2-oxoethyl)-3-oxo-1H-pyrazol-2-yl]benzoic acid (CAS 1050910-24-1) is a chemical compound with the molecular formula C13H12N2O5 and a molecular weight of 276.24 g/mol. IUPAC name: 4-[5-(2-methoxy-2-oxoethyl)-3-oxo-1H-pyrazol-2-yl]benzoic acid. InChIKey: LDQKGHZUWRHMNQ-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O5 |
|---|---|
| Molecular weight | 276.24 g/mol |
| IUPAC name | 4-[5-(2-methoxy-2-oxoethyl)-3-oxo-1H-pyrazol-2-yl]benzoic acid |
| InChIKey | LDQKGHZUWRHMNQ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=O)N(N1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)