Products 1820574-75-1
CAS 1820574-75-1 is the registry number for methyl (2S)-3-carbamoyl-2-(1,3-dioxoisoindol-2-yl)propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl (2S)-4-amino-2-(1,3-dioxoisoindol-2-yl)-4-oxobutanoate (CAS 1820574-75-1) is a chemical compound with the molecular formula C13H12N2O5 and a molecular weight of 276.24 g/mol. IUPAC name: methyl (2S)-4-amino-2-(1,3-dioxoisoindol-2-yl)-4-oxobutanoate. InChIKey: CSNQIBRHLRGLJE-VIFPVBQESA-N.
| Molecular formula | C13H12N2O5 |
|---|---|
| Molecular weight | 276.24 g/mol |
| IUPAC name | methyl (2S)-4-amino-2-(1,3-dioxoisoindol-2-yl)-4-oxobutanoate |
| InChIKey | CSNQIBRHLRGLJE-VIFPVBQESA-N |
| SMILES | COC(=O)[C@H](CC(=O)N)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)