CAS 2614-09-7 appears in our catalog under these names: 5-Amino-4-(1,3-dioxoisoindolin-2-yl)-5-oxopentanoic acid, 97%, 5-Amino-4-(1,3-dioxoisoindolin-2-yl)-5-oxopentanoic acid, ≥97%, ≥97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 10mg, 25mg, 100mg.
(4R)-5-amino-4-(1,3-dioxoisoindol-2-yl)-5-oxopentanoic acid (CAS 2614-09-7) is a chemical compound with the molecular formula C13H12N2O5 and a molecular weight of 276.24 g/mol. IUPAC name: (4R)-5-amino-4-(1,3-dioxoisoindol-2-yl)-5-oxopentanoic acid. InChIKey: CUBMYGDAHSAJPJ-SECBINFHSA-N.
| Molecular formula | C13H12N2O5 |
|---|---|
| Molecular weight | 276.24 g/mol |
| IUPAC name | (4R)-5-amino-4-(1,3-dioxoisoindol-2-yl)-5-oxopentanoic acid |
| InChIKey | CUBMYGDAHSAJPJ-SECBINFHSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)[C@H](CCC(=O)O)C(=O)N |
Computed by PubChem (NCBI)