Products 17896-84-3

CAS 17896-84-3 is the registry number for Pht-gly-beta-ala-oh, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]propanoic acid (CAS 17896-84-3) is a chemical compound with the molecular formula C13H12N2O5 and a molecular weight of 276.24 g/mol. IUPAC name: 3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]propanoic acid. InChIKey: QEFDVIRGCVDRLF-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12N2O5
Molecular weight276.24 g/mol
IUPAC name3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]propanoic acid
InChIKeyQEFDVIRGCVDRLF-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)N(C2=O)CC(=O)NCCC(=O)O

Computed by PubChem (NCBI)