CAS 17896-84-3 is the registry number for Pht-gly-beta-ala-oh, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]propanoic acid (CAS 17896-84-3) is a chemical compound with the molecular formula C13H12N2O5 and a molecular weight of 276.24 g/mol. IUPAC name: 3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]propanoic acid. InChIKey: QEFDVIRGCVDRLF-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O5 |
|---|---|
| Molecular weight | 276.24 g/mol |
| IUPAC name | 3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]propanoic acid |
| InChIKey | QEFDVIRGCVDRLF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC(=O)NCCC(=O)O |
Computed by PubChem (NCBI)