Products 110284-78-1

CAS 110284-78-1 appears in our catalog under these names: 2-((4,6-Dimethoxypyrimidin-2-yl)oxy)benzoic acid 95%, 2-[(4,6-Dimethoxypyrimidin-2-yl)oxy]benzoic acid, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoic acid (CAS 110284-78-1) is a chemical compound with the molecular formula C13H12N2O5 and a molecular weight of 276.24 g/mol. IUPAC name: 2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoic acid. InChIKey: KPJNHFDQZKAJKW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12N2O5
Molecular weight276.24 g/mol
IUPAC name2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoic acid
InChIKeyKPJNHFDQZKAJKW-UHFFFAOYSA-N
SMILESCOC1=CC(=NC(=N1)OC2=CC=CC=C2C(=O)O)OC

Computed by PubChem (NCBI)