CAS 1051383-44-8 appears in our catalog under these names: Spiro(piperidine-4,2'-pyrano(3,2-b)pyridin)-4'(3'H)-one dihydrochloride, 98%, 3',4'-Dihydrospiro(piperidine-4,2'-pyrano(3,2-b)pyridine)-4'-one dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
Spiro[3H-pyrano[3,2-b]pyridine-2,4'-piperidine]-4-one;dihydrochloride (CAS 1051383-44-8) is a chemical compound with the molecular formula C12H16Cl2N2O2 and a molecular weight of 291.17 g/mol. IUPAC name: spiro[3H-pyrano[3,2-b]pyridine-2,4'-piperidine]-4-one;dihydrochloride. InChIKey: OJHOGAIDGCNVLX-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N2O2 |
|---|---|
| Molecular weight | 291.17 g/mol |
| IUPAC name | spiro[3H-pyrano[3,2-b]pyridine-2,4'-piperidine]-4-one;dihydrochloride |
| InChIKey | OJHOGAIDGCNVLX-UHFFFAOYSA-N |
| SMILES | C1CNCCC12CC(=O)C3=C(O2)C=CC=N3.Cl.Cl |
Computed by PubChem (NCBI)