CAS 1144037-44-4 is the registry number for 2–(4–chlorophenoxy)–1–(piperazin–1–yl)ethan–1–one hydrochloride. Offered by: GLPBio. Available pack sizes: 1g, 5g.
2-(4-chlorophenoxy)-1-piperazin-1-ylethanone;hydrochloride (CAS 1144037-44-4) is a chemical compound with the molecular formula C12H16Cl2N2O2 and a molecular weight of 291.17 g/mol. IUPAC name: 2-(4-chlorophenoxy)-1-piperazin-1-ylethanone;hydrochloride. InChIKey: XCZLNMCXBSFGJL-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N2O2 |
|---|---|
| Molecular weight | 291.17 g/mol |
| IUPAC name | 2-(4-chlorophenoxy)-1-piperazin-1-ylethanone;hydrochloride |
| InChIKey | XCZLNMCXBSFGJL-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)COC2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)