CAS 10516-54-8 is the registry number for (R)-2-([1,1'-Biphenyl]-4-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(4-phenylphenyl)propanoic acid (CAS 10516-54-8) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: (2R)-2-(4-phenylphenyl)propanoic acid. InChIKey: JALUUBQFLPUJMY-LLVKDONJSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | (2R)-2-(4-phenylphenyl)propanoic acid |
| InChIKey | JALUUBQFLPUJMY-LLVKDONJSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)