Products 10517-16-5
CAS 10517-16-5 is the registry number for 1,9-Dihydro-9-β-D-xylofuranosyl-6H-purin-6-one. Offered by: MedChemExpress. Available pack sizes: Get quote.
9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 10517-16-5) is a chemical compound with the molecular formula C10H12N4O5 and a molecular weight of 268.23 g/mol. IUPAC name: 9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: UGQMRVRMYYASKQ-GAWUUDPSSA-N.
| Molecular formula | C10H12N4O5 |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | 9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | UGQMRVRMYYASKQ-GAWUUDPSSA-N |
| SMILES | C1=NC2=C(C(=O)N1)N=CN2[C@H]3[C@@H]([C@H]([C@H](O3)CO)O)O |
Computed by PubChem (NCBI)