Products 204634-01-5
CAS 204634-01-5 appears in our catalog under these names: Inosine–15N4, Inosine-15N4. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg.
9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 204634-01-5) is a chemical compound with the molecular formula C10H12N4O5 and a molecular weight of 272.20 g/mol. IUPAC name: 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: UGQMRVRMYYASKQ-SHKQESLVSA-N.
| Molecular formula | C10H12N4O5 |
|---|---|
| Molecular weight | 272.20 g/mol |
| IUPAC name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | UGQMRVRMYYASKQ-SHKQESLVSA-N |
| SMILES | C1=[15N]C2=C(C(=O)[15NH]1)[15N]=C[15N]2[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
Computed by PubChem (NCBI)
Synonyms:
Inosine-15N4, orb3138202