Products 105181-72-4

CAS 105181-72-4 is the registry number for Boc-(2R,3S)-AHPA. Offered by: Creative Peptides. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid (CAS 105181-72-4) is a chemical compound with the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. IUPAC name: 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid. InChIKey: BHTRKISIDQZUQX-UHFFFAOYSA-N.

Identity
Molecular formulaC15H21NO5
Molecular weight295.33 g/mol
IUPAC name2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid
InChIKeyBHTRKISIDQZUQX-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(CC1=CC=CC=C1)C(C(=O)O)O

Computed by PubChem (NCBI)