CAS 1052538-72-3 appears in our catalog under these names: 3-Chloro-4-(4-methylpiperazin-1-yl)aniline hydrochloride, 95%, 3–Chloro–4–(4–methylpiperazin–1–yl)aniline hydrochloride. Offered by: AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 10g, 5g.
3-chloro-4-(4-methylpiperazin-1-yl)aniline;hydrochloride (CAS 1052538-72-3) is a chemical compound with the molecular formula C11H17Cl2N3 and a molecular weight of 262.18 g/mol. IUPAC name: 3-chloro-4-(4-methylpiperazin-1-yl)aniline;hydrochloride. InChIKey: OGALTJHGPZGBRS-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2N3 |
|---|---|
| Molecular weight | 262.18 g/mol |
| IUPAC name | 3-chloro-4-(4-methylpiperazin-1-yl)aniline;hydrochloride |
| InChIKey | OGALTJHGPZGBRS-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=C(C=C2)N)Cl.Cl |
Computed by PubChem (NCBI)