CAS 1305712-10-0 is the registry number for 2-(1,5-Dimethyl-1H-1,3-benzodiazol-2-yl)ethan-1-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(1,5-dimethylbenzimidazol-2-yl)ethanamine;dihydrochloride (CAS 1305712-10-0) is a chemical compound with the molecular formula C11H17Cl2N3 and a molecular weight of 262.18 g/mol. IUPAC name: 2-(1,5-dimethylbenzimidazol-2-yl)ethanamine;dihydrochloride. InChIKey: DAFAKTQYEPWGHS-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2N3 |
|---|---|
| Molecular weight | 262.18 g/mol |
| IUPAC name | 2-(1,5-dimethylbenzimidazol-2-yl)ethanamine;dihydrochloride |
| InChIKey | DAFAKTQYEPWGHS-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C(=N2)CCN)C.Cl.Cl |
Computed by PubChem (NCBI)