CAS 1197821-90-1 appears in our catalog under these names: 2-Butyl-1H-1,3-benzodiazol-5-amine dihydrochloride, 95%, 2-Butyl-1H-1,3-benzodiazol-5-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-butyl-3H-benzimidazol-5-amine;dihydrochloride (CAS 1197821-90-1) is a chemical compound with the molecular formula C11H17Cl2N3 and a molecular weight of 262.18 g/mol. IUPAC name: 2-butyl-3H-benzimidazol-5-amine;dihydrochloride. InChIKey: VHCNSYJJLKZADN-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2N3 |
|---|---|
| Molecular weight | 262.18 g/mol |
| IUPAC name | 2-butyl-3H-benzimidazol-5-amine;dihydrochloride |
| InChIKey | VHCNSYJJLKZADN-UHFFFAOYSA-N |
| SMILES | CCCCC1=NC2=C(N1)C=C(C=C2)N.Cl.Cl |
Computed by PubChem (NCBI)