CAS 1158323-70-6 appears in our catalog under these names: 2-Isopropyl-1-methyl-1H-benzo(d)imidazol-5-amine dihydrochloride, 97%, 2-Isopropyl-1-methyl-1 H -benzoimidazol-5-ylamine, dihydrochloride. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g.
1-methyl-2-propan-2-ylbenzimidazol-5-amine;dihydrochloride (CAS 1158323-70-6) is a chemical compound with the molecular formula C11H17Cl2N3 and a molecular weight of 262.18 g/mol. IUPAC name: 1-methyl-2-propan-2-ylbenzimidazol-5-amine;dihydrochloride. InChIKey: XKIMFGUHEXUGGQ-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2N3 |
|---|---|
| Molecular weight | 262.18 g/mol |
| IUPAC name | 1-methyl-2-propan-2-ylbenzimidazol-5-amine;dihydrochloride |
| InChIKey | XKIMFGUHEXUGGQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC2=C(N1C)C=CC(=C2)N.Cl.Cl |
Computed by PubChem (NCBI)