CAS 1158292-10-4 is the registry number for 2-(4,5-Dimethyl-1h-benzimidazol-2-yl)ethanamine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethanamine;dihydrochloride (CAS 1158292-10-4) is a chemical compound with the molecular formula C11H17Cl2N3 and a molecular weight of 262.18 g/mol. IUPAC name: 2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethanamine;dihydrochloride. InChIKey: NNTCNPJEYHDSTN-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2N3 |
|---|---|
| Molecular weight | 262.18 g/mol |
| IUPAC name | 2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethanamine;dihydrochloride |
| InChIKey | NNTCNPJEYHDSTN-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)NC(=N2)CCN)C.Cl.Cl |
Computed by PubChem (NCBI)