CAS 864169-35-7 appears in our catalog under these names: 2-Chloro-5,6-dimethoxybenzo(d)thiazole, 97%, 2-Chloro-5,6-dimethoxy-1,3-benzothiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 100mg.
2-chloro-5,6-dimethoxy-1,3-benzothiazole (CAS 864169-35-7) is a chemical compound with the molecular formula C9H8ClNO2S and a molecular weight of 229.68 g/mol. IUPAC name: 2-chloro-5,6-dimethoxy-1,3-benzothiazole. InChIKey: VQLUSLHALUKRLE-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2S |
|---|---|
| Molecular weight | 229.68 g/mol |
| IUPAC name | 2-chloro-5,6-dimethoxy-1,3-benzothiazole |
| InChIKey | VQLUSLHALUKRLE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=C(S2)Cl)OC |
Computed by PubChem (NCBI)