Products 1052558-50-5

CAS 1052558-50-5 is the registry number for 1-(2,4-Difluorophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-carboxylic acid (CAS 1052558-50-5) is a chemical compound with the molecular formula C12H10F2N2O2 and a molecular weight of 252.22 g/mol. IUPAC name: 1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-carboxylic acid. InChIKey: XMTWMAIWNVBBBV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10F2N2O2
Molecular weight252.22 g/mol
IUPAC name1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-carboxylic acid
InChIKeyXMTWMAIWNVBBBV-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1C2=C(C=C(C=C2)F)F)C)C(=O)O

Computed by PubChem (NCBI)