CAS 1275813-46-1 is the registry number for Methyl 2-(2,4-difluorophenyl)-5-methyl-1H-imidazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(2,4-difluorophenyl)-5-methyl-1H-imidazole-4-carboxylate (CAS 1275813-46-1) is a chemical compound with the molecular formula C12H10F2N2O2 and a molecular weight of 252.22 g/mol. IUPAC name: methyl 2-(2,4-difluorophenyl)-5-methyl-1H-imidazole-4-carboxylate. InChIKey: QTWJYWIAAIEGRX-UHFFFAOYSA-N.
| Molecular formula | C12H10F2N2O2 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | methyl 2-(2,4-difluorophenyl)-5-methyl-1H-imidazole-4-carboxylate |
| InChIKey | QTWJYWIAAIEGRX-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(N1)C2=C(C=C(C=C2)F)F)C(=O)OC |
Computed by PubChem (NCBI)