CAS 1187635-57-9 is the registry number for Ethyl 5-(3,4-difluorophenyl)-2H-pyrazole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Ethyl 3-(3,4-difluorophenyl)-1H-pyrazole-5-carboxylate (CAS 1187635-57-9) is a chemical compound with the molecular formula C12H10F2N2O2 and a molecular weight of 252.22 g/mol. IUPAC name: ethyl 3-(3,4-difluorophenyl)-1H-pyrazole-5-carboxylate. InChIKey: GAIDJRVZKLFACI-UHFFFAOYSA-N.
| Molecular formula | C12H10F2N2O2 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | ethyl 3-(3,4-difluorophenyl)-1H-pyrazole-5-carboxylate |
| InChIKey | GAIDJRVZKLFACI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NN1)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)