CAS 541505-10-6 appears in our catalog under these names: (E)-Ethyl 2-cyano-3-(3,5-difluorophenylamino)acrylate, 95%, (E)-ethyl 2-cyano-3-((3,5-difluorophenyl)amino)acrylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg, 0,5g.
Ethyl (E)-2-cyano-3-(3,5-difluoroanilino)prop-2-enoate (CAS 541505-10-6) is a chemical compound with the molecular formula C12H10F2N2O2 and a molecular weight of 252.22 g/mol. IUPAC name: ethyl (E)-2-cyano-3-(3,5-difluoroanilino)prop-2-enoate. InChIKey: ZFMQPVALOWKRKZ-BQYQJAHWSA-N.
| Molecular formula | C12H10F2N2O2 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | ethyl (E)-2-cyano-3-(3,5-difluoroanilino)prop-2-enoate |
| InChIKey | ZFMQPVALOWKRKZ-BQYQJAHWSA-N |
| SMILES | CCOC(=O)/C(=C/NC1=CC(=CC(=C1)F)F)/C#N |
Computed by PubChem (NCBI)