CAS 115342-21-7 is the registry number for Ethyl 1-(2,4-difluorophenyl)-1H-pyrazole-3-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Ethyl 1-(2,4-difluorophenyl)pyrazole-3-carboxylate (CAS 115342-21-7) is a chemical compound with the molecular formula C12H10F2N2O2 and a molecular weight of 252.22 g/mol. IUPAC name: ethyl 1-(2,4-difluorophenyl)pyrazole-3-carboxylate. InChIKey: VEDNRWNEDZHKJG-UHFFFAOYSA-N.
| Molecular formula | C12H10F2N2O2 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | ethyl 1-(2,4-difluorophenyl)pyrazole-3-carboxylate |
| InChIKey | VEDNRWNEDZHKJG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C=C1)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)