CAS 340-06-7 appears in our catalog under these names: (S)–(+)–α–(Trifluoromethyl)benzyl Alcohol, (S)-(+)-alpha-(Trifluoromethyl)benzyl Alcohol, >98.0%(GC), (S)-(+)-alpha-(Trifluoromethyl)benzyl alcohol, 99%, (S)-2,2,2-Trifluoro-1-phenylethanol 98%, (S)-(+)-ALPHA-(TRIFLUOROMETHYL)BENZYL. Offered by: GLPBio, TCI, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 250mg, 5g, 100g, 100mg, 10g, 25g.
2,2,2-trifluoro-1-phenylethanol (CAS 340-06-7) is a chemical compound with the molecular formula C8H7F3O and a molecular weight of 176.14 g/mol. IUPAC name: 2,2,2-trifluoro-1-phenylethanol. InChIKey: VNOMEAQPOMDWSR-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O |
|---|---|
| Molecular weight | 176.14 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-phenylethanol |
| InChIKey | VNOMEAQPOMDWSR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(F)(F)F)O |
Computed by PubChem (NCBI)