CAS 340-04-5 is the registry number for α-(Trifluoromethyl)benzyl alcohol. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
2,2,2-trifluoro-1-phenylethanol (CAS 340-04-5) is a chemical compound with the molecular formula C8H7F3O and a molecular weight of 176.14 g/mol. IUPAC name: 2,2,2-trifluoro-1-phenylethanol. InChIKey: VNOMEAQPOMDWSR-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O |
|---|---|
| Molecular weight | 176.14 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-phenylethanol |
| InChIKey | VNOMEAQPOMDWSR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(F)(F)F)O |
Computed by PubChem (NCBI)