CAS 340-05-6 appears in our catalog under these names: alpha-(Trifluoromethyl)benzyl Alcohol, >98.0%(GC), 2,2,2-Trifluoro-1-phenylethan-1-ol 98%, ALPHA-(TRIFLUOROMETHYL)BENZYL ALCOHOL, &, 1-Phenyl-2,2,2-trifluoroethanol, 97%, 97%, 1-Phenyl-2,2,2-trifluoroethanol, 97%. Offered by: TCI, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 100mg, 250mg.
2,2,2-trifluoro-1-phenylethanol (CAS 340-05-6) is a chemical compound with the molecular formula C8H7F3O and a molecular weight of 176.14 g/mol. IUPAC name: 2,2,2-trifluoro-1-phenylethanol. InChIKey: VNOMEAQPOMDWSR-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O |
|---|---|
| Molecular weight | 176.14 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-phenylethanol |
| InChIKey | VNOMEAQPOMDWSR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(F)(F)F)O |
Computed by PubChem (NCBI)