CAS 105393-30-4 appears in our catalog under these names: Trans-2-(4-(tert-butyl)phenyl)cyclopropanecarboxylic acid, trans–2–(4–(tert–butyl)phenyl)cyclopropane–1–carboxylic acid. Offered by: Chemat, GLPBio. Available pack sizes: 500mg, 1g, 5g.
Trans-(1R,2R)-2-(4-tert-butylphenyl)cyclopropane-1-carboxylic acid (CAS 105393-30-4) is a chemical compound with the molecular formula C14H18O2 and a molecular weight of 218.29 g/mol. IUPAC name: trans-(1R,2R)-2-(4-tert-butylphenyl)cyclopropane-1-carboxylic acid. InChIKey: ANPQFLQUUUWDQU-NWDGAFQWSA-N.
| Molecular formula | C14H18O2 |
|---|---|
| Molecular weight | 218.29 g/mol |
| IUPAC name | trans-(1R,2R)-2-(4-tert-butylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | ANPQFLQUUUWDQU-NWDGAFQWSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)[C@@H]2C[C@H]2C(=O)O |
Computed by PubChem (NCBI)