Products 445029-32-3

CAS 445029-32-3 is the registry number for 2-(4-tert-Butylphenyl)cyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-(4-tert-butylphenyl)cyclopropane-1-carboxylic acid (CAS 445029-32-3) is a chemical compound with the molecular formula C14H18O2 and a molecular weight of 218.29 g/mol. IUPAC name: 2-(4-tert-butylphenyl)cyclopropane-1-carboxylic acid. InChIKey: ANPQFLQUUUWDQU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18O2
Molecular weight218.29 g/mol
IUPAC name2-(4-tert-butylphenyl)cyclopropane-1-carboxylic acid
InChIKeyANPQFLQUUUWDQU-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC=C(C=C1)C2CC2C(=O)O

Computed by PubChem (NCBI)