CAS 445029-32-3 is the registry number for 2-(4-tert-Butylphenyl)cyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(4-tert-butylphenyl)cyclopropane-1-carboxylic acid (CAS 445029-32-3) is a chemical compound with the molecular formula C14H18O2 and a molecular weight of 218.29 g/mol. IUPAC name: 2-(4-tert-butylphenyl)cyclopropane-1-carboxylic acid. InChIKey: ANPQFLQUUUWDQU-UHFFFAOYSA-N.
| Molecular formula | C14H18O2 |
|---|---|
| Molecular weight | 218.29 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | ANPQFLQUUUWDQU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2CC2C(=O)O |
Computed by PubChem (NCBI)