Products 1054003-08-5
CAS 1054003-08-5 appears in our catalog under these names: 1-[(5-Chlorothiophen-2-yl)carbonyl]piperidine-4-carboxylic acid, 95%, 1-(5-Chlorothiophene-2-carbonyl)piperidine-4-carboxylic acid, 95%, 1-(5-Chlorothiophene-2-carbonyl)piperidine-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 2,5g, 250mg.
1-(5-chlorothiophene-2-carbonyl)piperidine-4-carboxylic acid (CAS 1054003-08-5) is a chemical compound with the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. IUPAC name: 1-(5-chlorothiophene-2-carbonyl)piperidine-4-carboxylic acid. InChIKey: NIWGJCCPZJTOCX-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO3S |
|---|---|
| Molecular weight | 273.74 g/mol |
| IUPAC name | 1-(5-chlorothiophene-2-carbonyl)piperidine-4-carboxylic acid |
| InChIKey | NIWGJCCPZJTOCX-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)C(=O)C2=CC=C(S2)Cl |
Computed by PubChem (NCBI)