Products 927999-47-1

CAS 927999-47-1 is the registry number for 4-(2-Oxo-1-piperidinyl)benzenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(2-oxopiperidin-1-yl)benzenesulfonyl chloride (CAS 927999-47-1) is a chemical compound with the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. IUPAC name: 4-(2-oxopiperidin-1-yl)benzenesulfonyl chloride. InChIKey: IZLNKWGVRCTMQE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12ClNO3S
Molecular weight273.74 g/mol
IUPAC name4-(2-oxopiperidin-1-yl)benzenesulfonyl chloride
InChIKeyIZLNKWGVRCTMQE-UHFFFAOYSA-N
SMILESC1CCN(C(=O)C1)C2=CC=C(C=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)