CAS 156634-92-3 is the registry number for 1-[(4-Chlorophenyl)sulfonyl]tetrahydro-4(1h)-pyridinone, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g, 250mg.
1-(4-chlorophenyl)sulfonylpiperidin-4-one (CAS 156634-92-3) is a chemical compound with the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. IUPAC name: 1-(4-chlorophenyl)sulfonylpiperidin-4-one. InChIKey: MBFQWKZGVWXLGM-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO3S |
|---|---|
| Molecular weight | 273.74 g/mol |
| IUPAC name | 1-(4-chlorophenyl)sulfonylpiperidin-4-one |
| InChIKey | MBFQWKZGVWXLGM-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=O)S(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)